C19H14F3N3O2S — CID 10173050
ethyl 2-[3-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]pyrrolo[2,3-b]pyridin-1-yl]acetate (PubChem CID 10173050) has the molecular formula C19H14F3N3O2S and a molecular weight of 405.40 g/mol. Its IUPAC name is ethyl 2-[3-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]pyrrolo[2,3-b]pyridin-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]pyrrolo[2,3-b]pyridin-1-yl]acetate |
|---|---|
| PubChem CID | 10173050 |
| Molecular Formula | C19H14F3N3O2S |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | ethyl 2-[3-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]pyrrolo[2,3-b]pyridin-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(Cc2nc3c(F)c(F)cc(F)c3s2)c2cccnc21 |
| InChI | InChI=1S/C19H14F3N3O2S/c1-2-27-15(26)9-25-8-10(11-4-3-5-23-19(11)25)6-14-24-17-16(22)12(20)7-13(21)18(17)28-14/h3-5,7-8H,2,6,9H2,1H3 |
| InChIKey | CSMQAPDDWMJUSS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|