C19H22Cl2N4O2 — CID 10173107
6-[(3,4-dichlorophenyl)methylamino]-3-(5-methoxypentyl)-5H-imidazo[4,5-c]pyridin-4-one (PubChem CID 10173107) has the molecular formula C19H22Cl2N4O2 and a molecular weight of 409.32 g/mol. Its IUPAC name is 6-[(3,4-dichlorophenyl)methylamino]-3-(5-methoxypentyl)-5H-imidazo[4,5-c]pyridin-4-one.
| Compound Name | 6-[(3,4-dichlorophenyl)methylamino]-3-(5-methoxypentyl)-5H-imidazo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 10173107 |
| Molecular Formula | C19H22Cl2N4O2 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 6-[(3,4-dichlorophenyl)methylamino]-3-(5-methoxypentyl)-5H-imidazo[4,5-c]pyridin-4-one |
| SMILES | COCCCCCn1cnc2cc(NCc3ccc(Cl)c(Cl)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C19H22Cl2N4O2/c1-27-8-4-2-3-7-25-12-23-16-10-17(24-19(26)18(16)25)22-11-13-5-6-14(20)15(21)9-13/h5-6,9-10,12H,2-4,7-8,11H2,1H3,(H2,22,24,26) |
| InChIKey | TXUDUMMGJQJCQK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|