C26H25NO4 — CID 10173217
2-hydroxy-4-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-2,4-diphenylpentanamide (PubChem CID 10173217) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-2,4-diphenylpentanamide.
| Compound Name | 2-hydroxy-4-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-2,4-diphenylpentanamide |
|---|---|
| PubChem CID | 10173217 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-hydroxy-4-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-2,4-diphenylpentanamide |
| SMILES | CC(C)(CC(O)(C(=O)Nc1ccc2c(c1)COC2=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H25NO4/c1-25(2,19-9-5-3-6-10-19)17-26(30,20-11-7-4-8-12-20)24(29)27-21-13-14-22-18(15-21)16-31-23(22)28/h3-15,30H,16-17H2,1-2H3,(H,27,29) |
| InChIKey | HQVKFEYATUGVGI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |