C22H21F3N2O4 — CID 10173505
4-[(3aR,5R,7aS)-5-(cyclopropylmethoxy)-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 10173505) has the molecular formula C22H21F3N2O4 and a molecular weight of 434.41 g/mol. Its IUPAC name is 4-[(3aR,5R,7aS)-5-(cyclopropylmethoxy)-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,5R,7aS)-5-(cyclopropylmethoxy)-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 10173505 |
| Molecular Formula | C22H21F3N2O4 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 4-[(3aR,5R,7aS)-5-(cyclopropylmethoxy)-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC12C[C@@H](OCC3CC3)C(C)(O1)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C22H21F3N2O4/c1-20-8-15(30-10-11-3-4-11)21(2,31-20)17-16(20)18(28)27(19(17)29)13-6-5-12(9-26)14(7-13)22(23,24)25/h5-7,11,15-17H,3-4,8,10H2,1-2H3/t15-,16-,17+,20?,21?/m1/s1 |
| InChIKey | DRDZCHYNVSLUQA-QGGNESHTSA-N |
| XLogP | 3.43 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|