About 4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole
4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole (PubChem CID 10173628) has the molecular formula C24H21Cl2FN2O
and a molecular weight of 443.35 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 10173628 |
| Molecular Formula | C24H21Cl2FN2O |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole |
| SMILES | CC(C)Oc1cc(F)ccc1C1=NC(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C24H21Cl2FN2O/c1-14(2)30-21-13-19(27)11-12-20(21)24-28-22(15-3-7-17(25)8-4-15)23(29-24)16-5-9-18(26)10-6-16/h3-14,22-23H,1-2H3,(H,28,29) |
| InChIKey | MRGUYDKGRDHPAN-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole (CID 10173628) is 4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole is CC(C)Oc1cc(F)ccc1C1=NC(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)N1.
What is the InChIKey of 4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole?
The InChIKey is MRGUYDKGRDHPAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21Cl2FN2O/c1-14(2)30-21-13-19(27)11-12-20(21)24-28-22(15-3-7-17(25)8-4-15)23(29-24)16-5-9-18(26)10-6-16/h3-14,22-23H,1-2H3,(H,28,29).
What are the key properties of 4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole?
4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole has a molecular weight of 443.35 g/mol, XLogP of 6.75, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(4-chlorophenyl)-2-(4-fluoro-2-propan-2-yloxyphenyl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 10173628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).