C28H29NO4 — CID 10173634
2-hydroxy-4-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-4-phenyl-2-(2-phenylethyl)pentanamide (PubChem CID 10173634) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-4-phenyl-2-(2-phenylethyl)pentanamide.
| Compound Name | 2-hydroxy-4-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-4-phenyl-2-(2-phenylethyl)pentanamide |
|---|---|
| PubChem CID | 10173634 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 2-hydroxy-4-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-4-phenyl-2-(2-phenylethyl)pentanamide |
| SMILES | CC(C)(CC(O)(CCc1ccccc1)C(=O)Nc1ccc2c(c1)COC2=O)c1ccccc1 |
| InChI | InChI=1S/C28H29NO4/c1-27(2,22-11-7-4-8-12-22)19-28(32,16-15-20-9-5-3-6-10-20)26(31)29-23-13-14-24-21(17-23)18-33-25(24)30/h3-14,17,32H,15-16,18-19H2,1-2H3,(H,29,31) |
| InChIKey | CTRKFGYVXQHNDJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |