C20H21N3O5S2 — CID 10173700
6-(7-methoxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(3-methylbutyl)thieno[3,2-b]pyridine-5,7-dione (PubChem CID 10173700) has the molecular formula C20H21N3O5S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 6-(7-methoxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(3-methylbutyl)thieno[3,2-b]pyridine-5,7-dione.
| Compound Name | 6-(7-methoxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(3-methylbutyl)thieno[3,2-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 10173700 |
| Molecular Formula | C20H21N3O5S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 6-(7-methoxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(3-methylbutyl)thieno[3,2-b]pyridine-5,7-dione |
| SMILES | COc1ccc2c(c1)S(=O)(=O)N=C(C1C(=O)c3sccc3N(CCC(C)C)C1=O)N2 |
| InChI | InChI=1S/C20H21N3O5S2/c1-11(2)6-8-23-14-7-9-29-18(14)17(24)16(20(23)25)19-21-13-5-4-12(28-3)10-15(13)30(26,27)22-19/h4-5,7,9-11,16H,6,8H2,1-3H3,(H,21,22) |
| InChIKey | MVISWJDAUUACSQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|