C18H14BrCl2N3O2 — CID 10173805
7a-[(4-bromophenyl)methyl]-2-(2,6-dichloro-4-pyridinyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 10173805) has the molecular formula C18H14BrCl2N3O2 and a molecular weight of 455.14 g/mol. Its IUPAC name is 7a-[(4-bromophenyl)methyl]-2-(2,6-dichloro-4-pyridinyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | 7a-[(4-bromophenyl)methyl]-2-(2,6-dichloro-4-pyridinyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 10173805 |
| Molecular Formula | C18H14BrCl2N3O2 |
| Molecular Weight | 455.14 g/mol |
| Exact Mass | 452.96 |
| IUPAC Name | 7a-[(4-bromophenyl)methyl]-2-(2,6-dichloro-4-pyridinyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | O=C1N(c2cc(Cl)nc(Cl)c2)C(=O)C2(Cc3ccc(Br)cc3)CCCN12 |
| InChI | InChI=1S/C18H14BrCl2N3O2/c19-12-4-2-11(3-5-12)10-18-6-1-7-23(18)17(26)24(16(18)25)13-8-14(20)22-15(21)9-13/h2-5,8-9H,1,6-7,10H2 |
| InChIKey | PZCATVUOFWMAQU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.14 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|