C13H20O — CID 101738277
trans-(1R,3R)-3-[(1E)-buta-1,3-dienyl]-1,2,2-trimethylcyclopentane-1-carbaldehyde (PubChem CID 101738277) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is trans-(1R,3R)-3-[(1E)-buta-1,3-dienyl]-1,2,2-trimethylcyclopentane-1-carbaldehyde.
| Compound Name | trans-(1R,3R)-3-[(1E)-buta-1,3-dienyl]-1,2,2-trimethylcyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 101738277 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | trans-(1R,3R)-3-[(1E)-buta-1,3-dienyl]-1,2,2-trimethylcyclopentane-1-carbaldehyde |
| SMILES | C[C@]1(CC[C@@H](C1(C)C)/C=C/C=C)C=O |
| InChI | InChI=1S/C13H20O/c1-5-6-7-11-8-9-13(4,10-14)12(11,2)3/h5-7,10-11H,1,8-9H2,2-4H3/b7-6+/t11-,13-/m0/s1 |
| InChIKey | FTFHUQIXMBRJCI-XTYWZOAOSA-N |
| XLogP | 3.50 |
| TPSA | 17.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | 262 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|