C23H22ClN7S — CID 10173951
2-N-[3-chloro-4-(diethylamino)phenyl]-4-N-(1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 10173951) has the molecular formula C23H22ClN7S and a molecular weight of 464.00 g/mol. Its IUPAC name is 2-N-[3-chloro-4-(diethylamino)phenyl]-4-N-(1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-chloro-4-(diethylamino)phenyl]-4-N-(1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 10173951 |
| Molecular Formula | C23H22ClN7S |
| Molecular Weight | 464.00 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 2-N-[3-chloro-4-(diethylamino)phenyl]-4-N-(1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2nc(Nc3ccc4[nH]ncc4c3)c3sccc3n2)cc1Cl |
| InChI | InChI=1S/C23H22ClN7S/c1-3-31(4-2)20-8-6-16(12-17(20)24)27-23-28-19-9-10-32-21(19)22(29-23)26-15-5-7-18-14(11-15)13-25-30-18/h5-13H,3-4H2,1-2H3,(H,25,30)(H2,26,27,28,29) |
| InChIKey | SNTATNAVBOJYNO-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.00 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|