C19H15F3N4O6S — CID 10174236
4-(4-nitronaphthalen-1-yl)-8-(2,2,2-trifluoroethylsulfonyl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 10174236) has the molecular formula C19H15F3N4O6S and a molecular weight of 484.41 g/mol. Its IUPAC name is 4-(4-nitronaphthalen-1-yl)-8-(2,2,2-trifluoroethylsulfonyl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 4-(4-nitronaphthalen-1-yl)-8-(2,2,2-trifluoroethylsulfonyl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 10174236 |
| Molecular Formula | C19H15F3N4O6S |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 4-(4-nitronaphthalen-1-yl)-8-(2,2,2-trifluoroethylsulfonyl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1C2C3CC(CN3S(=O)(=O)CC(F)(F)F)N2C(=O)N1c1ccc([N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C19H15F3N4O6S/c20-19(21,22)9-33(31,32)23-8-10-7-15(23)16-17(27)25(18(28)24(10)16)13-5-6-14(26(29)30)12-4-2-1-3-11(12)13/h1-6,10,15-16H,7-9H2 |
| InChIKey | XFKISTNGFYQZDY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|