C26H30Cl2N2O5 — CID 10174690
(2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[1-(4-hydroxybutyl)cyclopentanecarbonyl]amino]propanoic acid (PubChem CID 10174690) has the molecular formula C26H30Cl2N2O5 and a molecular weight of 521.44 g/mol. Its IUPAC name is (2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[1-(4-hydroxybutyl)cyclopentanecarbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[1-(4-hydroxybutyl)cyclopentanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10174690 |
| Molecular Formula | C26H30Cl2N2O5 |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | (2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[1-(4-hydroxybutyl)cyclopentanecarbonyl]amino]propanoic acid |
| SMILES | O=C(Nc1ccc(C[C@H](NC(=O)C2(CCCCO)CCCC2)C(=O)O)cc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H30Cl2N2O5/c27-19-6-5-7-20(28)22(19)23(32)29-18-10-8-17(9-11-18)16-21(24(33)34)30-25(35)26(12-1-2-13-26)14-3-4-15-31/h5-11,21,31H,1-4,12-16H2,(H,29,32)(H,30,35)(H,33,34)/t21-/m0/s1 |
| InChIKey | DWDDWGYZNYHOGW-NRFANRHFSA-N |
| XLogP | 5.08 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|