C26H24ClN5O3S — CID 10174706
5-chloro-N-[(3R)-2-oxooxolan-3-yl]-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide (PubChem CID 10174706) has the molecular formula C26H24ClN5O3S and a molecular weight of 522.03 g/mol. Its IUPAC name is 5-chloro-N-[(3R)-2-oxooxolan-3-yl]-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-[(3R)-2-oxooxolan-3-yl]-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10174706 |
| Molecular Formula | C26H24ClN5O3S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 5-chloro-N-[(3R)-2-oxooxolan-3-yl]-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCOC1=O)c1cnc(NNC(=S)NC2c3ccccc3CCc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C26H24ClN5O3S/c27-20-13-17(24(33)29-21-11-12-35-25(21)34)14-28-23(20)31-32-26(36)30-22-18-7-3-1-5-15(18)9-10-16-6-2-4-8-19(16)22/h1-8,13-14,21-22H,9-12H2,(H,28,31)(H,29,33)(H2,30,32,36)/t21-/m1/s1 |
| InChIKey | GYBLMKWYELQZOZ-OAQYLSRUSA-N |
| XLogP | 3.46 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|