C31H38N6O2 — CID 10174773
N-[2-[[2-phenyl-6-[[1-(3-phenylpropyl)piperidin-4-yl]oxymethyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 10174773) has the molecular formula C31H38N6O2 and a molecular weight of 526.69 g/mol. Its IUPAC name is N-[2-[[2-phenyl-6-[[1-(3-phenylpropyl)piperidin-4-yl]oxymethyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-phenyl-6-[[1-(3-phenylpropyl)piperidin-4-yl]oxymethyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 10174773 |
| Molecular Formula | C31H38N6O2 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | N-[2-[[2-phenyl-6-[[1-(3-phenylpropyl)piperidin-4-yl]oxymethyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc(-c2ccccc2)nc2[nH]c(COC3CCN(CCCc4ccccc4)CC3)cc12 |
| InChI | InChI=1S/C31H38N6O2/c1-23(38)32-16-17-33-30-28-21-26(34-31(28)36-29(35-30)25-12-6-3-7-13-25)22-39-27-14-19-37(20-15-27)18-8-11-24-9-4-2-5-10-24/h2-7,9-10,12-13,21,27H,8,11,14-20,22H2,1H3,(H,32,38)(H2,33,34,35,36) |
| InChIKey | QYMIKGNMRSXMPP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|