C27H23N5O7 — CID 10174798
5-(2-ethoxyethyl)-5-[4-[4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)phenoxy]phenoxy]-1,3-diazinane-2,4,6-trione (PubChem CID 10174798) has the molecular formula C27H23N5O7 and a molecular weight of 529.51 g/mol. Its IUPAC name is 5-(2-ethoxyethyl)-5-[4-[4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)phenoxy]phenoxy]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2-ethoxyethyl)-5-[4-[4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)phenoxy]phenoxy]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 10174798 |
| Molecular Formula | C27H23N5O7 |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 5-(2-ethoxyethyl)-5-[4-[4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)phenoxy]phenoxy]-1,3-diazinane-2,4,6-trione |
| SMILES | CCOCCC1(Oc2ccc(Oc3ccc(-c4nc(-c5ccncc5)no4)cc3)cc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C27H23N5O7/c1-2-36-16-13-27(24(33)30-26(35)31-25(27)34)38-21-9-7-20(8-10-21)37-19-5-3-18(4-6-19)23-29-22(32-39-23)17-11-14-28-15-12-17/h3-12,14-15H,2,13,16H2,1H3,(H2,30,31,33,34,35) |
| InChIKey | QKSNNIINMGAXNH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 154.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|