C28H23ClFN5OS — CID 10174828
5-chloro-N-(3-fluorophenyl)-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide (PubChem CID 10174828) has the molecular formula C28H23ClFN5OS and a molecular weight of 532.04 g/mol. Its IUPAC name is 5-chloro-N-(3-fluorophenyl)-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-(3-fluorophenyl)-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10174828 |
| Molecular Formula | C28H23ClFN5OS |
| Molecular Weight | 532.04 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 5-chloro-N-(3-fluorophenyl)-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cnc(NNC(=S)NC2c3ccccc3CCc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C28H23ClFN5OS/c29-24-14-19(27(36)32-21-9-5-8-20(30)15-21)16-31-26(24)34-35-28(37)33-25-22-10-3-1-6-17(22)12-13-18-7-2-4-11-23(18)25/h1-11,14-16,25H,12-13H2,(H,31,34)(H,32,36)(H2,33,35,37) |
| InChIKey | BCHQTZITTSVLBY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.04 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|