C27H26ClN5O2S2 — CID 10175018
5-chloro-N-(2-oxothiolan-3-yl)-6-[2-[[(1S,2R)-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]carbamothioyl]hydrazinyl]pyridine-3-carboxamide (PubChem CID 10175018) has the molecular formula C27H26ClN5O2S2 and a molecular weight of 552.13 g/mol. Its IUPAC name is 5-chloro-N-(2-oxothiolan-3-yl)-6-[2-[[(1S,2R)-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]carbamothioyl]hydrazinyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-(2-oxothiolan-3-yl)-6-[2-[[(1S,2R)-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]carbamothioyl]hydrazinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10175018 |
| Molecular Formula | C27H26ClN5O2S2 |
| Molecular Weight | 552.13 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 5-chloro-N-(2-oxothiolan-3-yl)-6-[2-[[(1S,2R)-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]carbamothioyl]hydrazinyl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCSC1=O)c1cnc(NNC(=S)N[C@@H]2c3ccccc3CC[C@@H]2c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C27H26ClN5O2S2/c28-21-14-18(25(34)30-22-12-13-37-26(22)35)15-29-24(21)32-33-27(36)31-23-19-9-5-4-8-17(19)10-11-20(23)16-6-2-1-3-7-16/h1-9,14-15,20,22-23H,10-13H2,(H,29,32)(H,30,34)(H2,31,33,36)/t20-,22?,23-/m1/s1 |
| InChIKey | VPMOQLVDSPEFLB-WPLVIQRKSA-N |
| XLogP | 4.76 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.13 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|