C34H27ClFNO8 — CID 10175492
(5S,5aS,8aR,9R)-5-[2-(4-chlorobenzoyl)-6-fluoroanilino]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one (PubChem CID 10175492) has the molecular formula C34H27ClFNO8 and a molecular weight of 632.04 g/mol. Its IUPAC name is (5S,5aS,8aR,9R)-5-[2-(4-chlorobenzoyl)-6-fluoroanilino]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one.
| Compound Name | (5S,5aS,8aR,9R)-5-[2-(4-chlorobenzoyl)-6-fluoroanilino]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 10175492 |
| Molecular Formula | C34H27ClFNO8 |
| Molecular Weight | 632.04 g/mol |
| Exact Mass | 631.14 |
| IUPAC Name | (5S,5aS,8aR,9R)-5-[2-(4-chlorobenzoyl)-6-fluoroanilino]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](Nc3c(F)cccc3C(=O)c3ccc(Cl)cc3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1O |
| InChI | InChI=1S/C34H27ClFNO8/c1-41-26-10-17(11-27(42-2)33(26)39)28-20-12-24-25(45-15-44-24)13-21(20)30(22-14-43-34(40)29(22)28)37-31-19(4-3-5-23(31)36)32(38)16-6-8-18(35)9-7-16/h3-13,22,28-30,37,39H,14-15H2,1-2H3/t22-,28+,29-,30+/m0/s1 |
| InChIKey | KGRMDXBSYGJTKJ-GEYQZXRLSA-N |
| XLogP | 6.25 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.04 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|