C36H38ClF3N2O3 — CID 10175511
tert-butyl N-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]carbamate (PubChem CID 10175511) has the molecular formula C36H38ClF3N2O3 and a molecular weight of 639.16 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 10175511 |
| Molecular Formula | C36H38ClF3N2O3 |
| Molecular Weight | 639.16 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | tert-butyl N-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C36H38ClF3N2O3/c1-35(2,3)45-34(43)41-29-18-11-19-30(23-29)44-22-12-21-42(24-28-17-10-20-32(33(28)37)36(38,39)40)25-31(26-13-6-4-7-14-26)27-15-8-5-9-16-27/h4-11,13-20,23,31H,12,21-22,24-25H2,1-3H3,(H,41,43) |
| InChIKey | GKYHWDKULWHIJL-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.16 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|