C39H39F4N3O3 — CID 10175603
N-(1,3-benzodioxol-5-ylmethyl)-N-[[3-butyl-5-(3,4-dimethylphenyl)-2-phenylimidazol-4-yl]methyl]-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanamine (PubChem CID 10175603) has the molecular formula C39H39F4N3O3 and a molecular weight of 673.75 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-[[3-butyl-5-(3,4-dimethylphenyl)-2-phenylimidazol-4-yl]methyl]-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanamine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[[3-butyl-5-(3,4-dimethylphenyl)-2-phenylimidazol-4-yl]methyl]-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 10175603 |
| Molecular Formula | C39H39F4N3O3 |
| Molecular Weight | 673.75 g/mol |
| Exact Mass | 673.29 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[[3-butyl-5-(3,4-dimethylphenyl)-2-phenylimidazol-4-yl]methyl]-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanamine |
| SMILES | CCCCn1c(-c2ccccc2)nc(-c2ccc(C)c(C)c2)c1CN(Cc1cccc(OC(F)(F)C(F)F)c1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C39H39F4N3O3/c1-4-5-18-46-33(36(31-16-14-26(2)27(3)19-31)44-37(46)30-11-7-6-8-12-30)24-45(23-29-15-17-34-35(21-29)48-25-47-34)22-28-10-9-13-32(20-28)49-39(42,43)38(40)41/h6-17,19-21,38H,4-5,18,22-25H2,1-3H3 |
| InChIKey | LXJSSKURSZVJGZ-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.75 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|