C4H11NO2 — CID 10176108
2-(aminomethyl)propane-1,3-diol (PubChem CID 10176108) has the molecular formula C4H11NO2 and a molecular weight of 105.14 g/mol. Its IUPAC name is 2-(aminomethyl)propane-1,3-diol.
| Compound Name | 2-(aminomethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 10176108 |
| Molecular Formula | C4H11NO2 |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.08 |
| IUPAC Name | 2-(aminomethyl)propane-1,3-diol |
| SMILES | NCC(CO)CO |
| InChI | InChI=1S/C4H11NO2/c5-1-4(2-6)3-7/h4,6-7H,1-3,5H2 |
| InChIKey | IDUWIXCWGYJVKL-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |