About 3-formylpentanenitrile
3-formylpentanenitrile (PubChem CID 10176115) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is 3-formylpentanenitrile.
Molecular Properties
| Compound Name | 3-formylpentanenitrile |
| PubChem CID | 10176115 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 3-formylpentanenitrile |
| SMILES | CCC(C=O)CC#N |
| InChI | InChI=1S/C6H9NO/c1-2-6(5-8)3-4-7/h5-6H,2-3H2,1H3 |
| InChIKey | ZHYXXZIETYEENU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-formylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-formylpentanenitrile?
The IUPAC name of 3-formylpentanenitrile (CID 10176115) is 3-formylpentanenitrile.
What is the SMILES notation for 3-formylpentanenitrile?
The canonical SMILES for 3-formylpentanenitrile is CCC(C=O)CC#N.
What is the InChIKey of 3-formylpentanenitrile?
The InChIKey is ZHYXXZIETYEENU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO/c1-2-6(5-8)3-4-7/h5-6H,2-3H2,1H3.
What are the key properties of 3-formylpentanenitrile?
3-formylpentanenitrile has a molecular weight of 111.14 g/mol, XLogP of 1.13, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-formylpentanenitrile is sourced from PubChem (CID 10176115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).