About 1H-pyrazole-3,4,5-triamine
1H-pyrazole-3,4,5-triamine (PubChem CID 10176120) has the molecular formula C3H7N5
and a molecular weight of 113.12 g/mol. Its IUPAC name is 1H-pyrazole-3,4,5-triamine.
Molecular Properties
| Compound Name | 1H-pyrazole-3,4,5-triamine |
| PubChem CID | 10176120 |
| Molecular Formula | C3H7N5 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.07 |
| IUPAC Name | 1H-pyrazole-3,4,5-triamine |
| SMILES | Nc1n[nH]c(N)c1N |
| InChI | InChI=1S/C3H7N5/c4-1-2(5)7-8-3(1)6/h4H2,(H5,5,6,7,8) |
| InChIKey | WXFKWEVAPSWLOI-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-pyrazole-3,4,5-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole-3,4,5-triamine?
The IUPAC name of 1H-pyrazole-3,4,5-triamine (CID 10176120) is 1H-pyrazole-3,4,5-triamine.
What is the SMILES notation for 1H-pyrazole-3,4,5-triamine?
The canonical SMILES for 1H-pyrazole-3,4,5-triamine is Nc1n[nH]c(N)c1N.
What is the InChIKey of 1H-pyrazole-3,4,5-triamine?
The InChIKey is WXFKWEVAPSWLOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N5/c4-1-2(5)7-8-3(1)6/h4H2,(H5,5,6,7,8).
What are the key properties of 1H-pyrazole-3,4,5-triamine?
1H-pyrazole-3,4,5-triamine has a molecular weight of 113.12 g/mol, XLogP of -0.84, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole-3,4,5-triamine is sourced from PubChem (CID 10176120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).