About 3-methylpentanamide
3-methylpentanamide (PubChem CID 10176126) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is 3-methylpentanamide.
Molecular Properties
| Compound Name | 3-methylpentanamide |
| PubChem CID | 10176126 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | 3-methylpentanamide |
| SMILES | CCC(C)CC(N)=O |
| InChI | InChI=1S/C6H13NO/c1-3-5(2)4-6(7)8/h5H,3-4H2,1-2H3,(H2,7,8) |
| InChIKey | SIMLCFANWCDGAF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentanamide?
The IUPAC name of 3-methylpentanamide (CID 10176126) is 3-methylpentanamide.
What is the SMILES notation for 3-methylpentanamide?
The canonical SMILES for 3-methylpentanamide is CCC(C)CC(N)=O.
What is the InChIKey of 3-methylpentanamide?
The InChIKey is SIMLCFANWCDGAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO/c1-3-5(2)4-6(7)8/h5H,3-4H2,1-2H3,(H2,7,8).
What are the key properties of 3-methylpentanamide?
3-methylpentanamide has a molecular weight of 115.18 g/mol, XLogP of 0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentanamide is sourced from PubChem (CID 10176126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).