About 1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride
1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride (PubChem CID 10176283) has the molecular formula C3H8ClN5O
and a molecular weight of 165.58 g/mol. Its IUPAC name is 1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride |
| PubChem CID | 10176283 |
| Molecular Formula | C3H8ClN5O |
| Molecular Weight | 165.58 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride |
| SMILES | Cl.[H]/N=C1\N(N)CC(=O)N1N |
| InChI | InChI=1S/C3H7N5O.ClH/c4-3-7(5)1-2(9)8(3)6;/h4H,1,5-6H2;1H/b4-3+; |
| InChIKey | CHOMLAGDAURZHS-BJILWQEISA-N |
| XLogP | -1.77 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.58 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride?
The IUPAC name of 1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride (CID 10176283) is 1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride.
What is the SMILES notation for 1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride?
The canonical SMILES for 1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride is Cl.[H]/N=C1\N(N)CC(=O)N1N.
What is the InChIKey of 1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride?
The InChIKey is CHOMLAGDAURZHS-BJILWQEISA-N. The full InChI is InChI=1S/C3H7N5O.ClH/c4-3-7(5)1-2(9)8(3)6;/h4H,1,5-6H2;1H/b4-3+;.
What are the key properties of 1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride?
1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride has a molecular weight of 165.58 g/mol, XLogP of -1.77, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diamino-2-iminoimidazolidin-4-one;hydrochloride is sourced from PubChem (CID 10176283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).