About 2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene
2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene (PubChem CID 10176302) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene.
Molecular Properties
| Compound Name | 2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene |
| PubChem CID | 10176302 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene |
| SMILES | CC1=NC2(CCN(C)CC2)CO1 |
| InChI | InChI=1S/C9H16N2O/c1-8-10-9(7-12-8)3-5-11(2)6-4-9/h3-7H2,1-2H3 |
| InChIKey | VGPXROMBXGVRRS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene?
The IUPAC name of 2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene (CID 10176302) is 2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene.
What is the SMILES notation for 2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene?
The canonical SMILES for 2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene is CC1=NC2(CCN(C)CC2)CO1.
What is the InChIKey of 2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene?
The InChIKey is VGPXROMBXGVRRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-8-10-9(7-12-8)3-5-11(2)6-4-9/h3-7H2,1-2H3.
What are the key properties of 2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene?
2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene has a molecular weight of 168.24 g/mol, XLogP of 0.90, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dimethyl-3-oxa-1,8-diazaspiro[4.5]dec-1-ene is sourced from PubChem (CID 10176302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).