methoxy-N,N-di(propan-2-yl)phosphonamidous acid

C7H18NO2P — CID 10176368

IUPACmethoxy-N,N-di(propan-2-yl)phosphonamidous acid
SMILESCOP(O)N(C(C)C)C(C)C
InChIInChI=1S/C7H18NO2P/c1-6(2)8(7(3)4)11(9)10-5/h6-7,9H,1-5H3
InChIKeyHTPMNIMWEGERPS-UHFFFAOYSA-N
MW179.20 g/mol
LogP1.97
Rot. Bonds4

About methoxy-N,N-di(propan-2-yl)phosphonamidous acid

methoxy-N,N-di(propan-2-yl)phosphonamidous acid (PubChem CID 10176368) has the molecular formula C7H18NO2P and a molecular weight of 179.20 g/mol. Its IUPAC name is methoxy-N,N-di(propan-2-yl)phosphonamidous acid.

Molecular Properties

Compound Namemethoxy-N,N-di(propan-2-yl)phosphonamidous acid
PubChem CID10176368
Molecular FormulaC7H18NO2P
Molecular Weight179.20 g/mol
Exact Mass179.11
IUPAC Namemethoxy-N,N-di(propan-2-yl)phosphonamidous acid
SMILESCOP(O)N(C(C)C)C(C)C
InChIInChI=1S/C7H18NO2P/c1-6(2)8(7(3)4)11(9)10-5/h6-7,9H,1-5H3
InChIKeyHTPMNIMWEGERPS-UHFFFAOYSA-N
XLogP1.97
TPSA32.70 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.20
LogP ≤ 51.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze methoxy-N,N-di(propan-2-yl)phosphonamidous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methoxy-N,N-di(propan-2-yl)phosphonamidous acid?
The IUPAC name of methoxy-N,N-di(propan-2-yl)phosphonamidous acid (CID 10176368) is methoxy-N,N-di(propan-2-yl)phosphonamidous acid.
What is the SMILES notation for methoxy-N,N-di(propan-2-yl)phosphonamidous acid?
The canonical SMILES for methoxy-N,N-di(propan-2-yl)phosphonamidous acid is COP(O)N(C(C)C)C(C)C.
What is the InChIKey of methoxy-N,N-di(propan-2-yl)phosphonamidous acid?
The InChIKey is HTPMNIMWEGERPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18NO2P/c1-6(2)8(7(3)4)11(9)10-5/h6-7,9H,1-5H3.
What are the key properties of methoxy-N,N-di(propan-2-yl)phosphonamidous acid?
methoxy-N,N-di(propan-2-yl)phosphonamidous acid has a molecular weight of 179.20 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy-N,N-di(propan-2-yl)phosphonamidous acid is sourced from PubChem (CID 10176368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).