C13H17N — CID 10176442
(4aR,9aS)-1,2,3,4,9,9a-hexahydrofluoren-4a-amine (PubChem CID 10176442) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (4aR,9aS)-1,2,3,4,9,9a-hexahydrofluoren-4a-amine.
| Compound Name | (4aR,9aS)-1,2,3,4,9,9a-hexahydrofluoren-4a-amine |
|---|---|
| PubChem CID | 10176442 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (4aR,9aS)-1,2,3,4,9,9a-hexahydrofluoren-4a-amine |
| SMILES | N[C@]12CCCC[C@H]1Cc1ccccc12 |
| InChI | InChI=1S/C13H17N/c14-13-8-4-3-6-11(13)9-10-5-1-2-7-12(10)13/h1-2,5,7,11H,3-4,6,8-9,14H2/t11-,13+/m0/s1 |
| InChIKey | NUOQOLUXBAFBAG-WCQYABFASA-N |
| XLogP | 2.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |