C6H13N5 — CID 10176487
6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine (PubChem CID 10176487) has the molecular formula C6H13N5 and a molecular weight of 155.20 g/mol. Its IUPAC name is 6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine.
| Compound Name | 6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 10176487 |
| Molecular Formula | C6H13N5 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.12 |
| IUPAC Name | 6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
| SMILES | CC1N=C(N)NC(N(C)C)=N1 |
| InChI | InChI=1S/C6H13N5/c1-4-8-5(7)10-6(9-4)11(2)3/h4H,1-3H3,(H3,7,8,9,10) |
| InChIKey | GFICWFZTBXUVIG-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |