About 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane
7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane (PubChem CID 10176607) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane |
| PubChem CID | 10176607 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane |
| SMILES | c1cncc(N2CCC3(CCCN3)C2)c1 |
| InChI | InChI=1S/C12H17N3/c1-3-11(9-13-6-1)15-8-5-12(10-15)4-2-7-14-12/h1,3,6,9,14H,2,4-5,7-8,10H2 |
| InChIKey | NXIPMBQVNTWEEX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane?
The IUPAC name of 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane (CID 10176607) is 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane?
The canonical SMILES for 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane is c1cncc(N2CCC3(CCCN3)C2)c1.
What is the InChIKey of 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane?
The InChIKey is NXIPMBQVNTWEEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3/c1-3-11(9-13-6-1)15-8-5-12(10-15)4-2-7-14-12/h1,3,6,9,14H,2,4-5,7-8,10H2.
What are the key properties of 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane?
7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane has a molecular weight of 203.29 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 10176607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).