About 5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole
5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole (PubChem CID 10176715) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 10176715 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole |
| SMILES | C1=NCC(CC2=Cc3ccccc3CC2)N1 |
| InChI | InChI=1S/C14H16N2/c1-2-4-13-7-11(5-6-12(13)3-1)8-14-9-15-10-16-14/h1-4,7,10,14H,5-6,8-9H2,(H,15,16) |
| InChIKey | WNPGIHKSPQIODH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole (CID 10176715) is 5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole is C1=NCC(CC2=Cc3ccccc3CC2)N1.
What is the InChIKey of 5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole?
The InChIKey is WNPGIHKSPQIODH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2/c1-2-4-13-7-11(5-6-12(13)3-1)8-14-9-15-10-16-14/h1-4,7,10,14H,5-6,8-9H2,(H,15,16).
What are the key properties of 5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole?
5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole has a molecular weight of 212.30 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 10176715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).