C12H15ClN2 — CID 10176869
(10aS)-7-chloro-6-methyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole (PubChem CID 10176869) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is (10aS)-7-chloro-6-methyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole.
| Compound Name | (10aS)-7-chloro-6-methyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 10176869 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (10aS)-7-chloro-6-methyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole |
| SMILES | Cc1c(Cl)ccc2c1N1CCNC[C@@H]1C2 |
| InChI | InChI=1S/C12H15ClN2/c1-8-11(13)3-2-9-6-10-7-14-4-5-15(10)12(8)9/h2-3,10,14H,4-7H2,1H3/t10-/m0/s1 |
| InChIKey | PRMDFIDXMNQOIN-JTQLQIEISA-N |
| XLogP | 1.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |