C10H16N2O4 — CID 10176941
1-(5,6-dimethylpyrazin-2-yl)butane-1,2,3,4-tetrol (PubChem CID 10176941) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 1-(5,6-dimethylpyrazin-2-yl)butane-1,2,3,4-tetrol.
| Compound Name | 1-(5,6-dimethylpyrazin-2-yl)butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 10176941 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1-(5,6-dimethylpyrazin-2-yl)butane-1,2,3,4-tetrol |
| SMILES | Cc1ncc(C(O)C(O)C(O)CO)nc1C |
| InChI | InChI=1S/C10H16N2O4/c1-5-6(2)12-7(3-11-5)9(15)10(16)8(14)4-13/h3,8-10,13-16H,4H2,1-2H3 |
| InChIKey | SODTXIONAXHBSY-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |