About 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride
2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride (PubChem CID 10176995) has the molecular formula C11H19ClN2O
and a molecular weight of 230.74 g/mol. Its IUPAC name is 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride.
Molecular Properties
| Compound Name | 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride |
| PubChem CID | 10176995 |
| Molecular Formula | C11H19ClN2O |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1.Cl |
| InChI | InChI=1S/C11H18N2O.ClH/c1-2-3-6-9-12-10(14)11(13-9)7-4-5-8-11;/h2-8H2,1H3,(H,12,13,14);1H |
| InChIKey | WWRHZLCKSVQRBG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride?
The IUPAC name of 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride (CID 10176995) is 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride.
What is the SMILES notation for 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride?
The canonical SMILES for 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride is CCCCC1=NC2(CCCC2)C(=O)N1.Cl.
What is the InChIKey of 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride?
The InChIKey is WWRHZLCKSVQRBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O.ClH/c1-2-3-6-9-12-10(14)11(13-9)7-4-5-8-11;/h2-8H2,1H3,(H,12,13,14);1H.
What are the key properties of 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride?
2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride has a molecular weight of 230.74 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride is sourced from PubChem (CID 10176995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).