About N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine
N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine (PubChem CID 10177126) has the molecular formula C20H21F2N5
and a molecular weight of 369.42 g/mol. Its IUPAC name is N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine |
| PubChem CID | 10177126 |
| Molecular Formula | C20H21F2N5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine |
| SMILES | Cc1nn(-c2ccc(F)cc2F)cc1-c1ccnc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C20H21F2N5/c1-13-16(12-27(26-13)19-8-7-14(21)11-17(19)22)18-9-10-23-20(25-18)24-15-5-3-2-4-6-15/h7-12,15H,2-6H2,1H3,(H,23,24,25) |
| InChIKey | MEANSZMZZPMMIP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine?
The IUPAC name of N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine (CID 10177126) is N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine.
What is the SMILES notation for N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine?
The canonical SMILES for N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine is Cc1nn(-c2ccc(F)cc2F)cc1-c1ccnc(NC2CCCCC2)n1.
What is the InChIKey of N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine?
The InChIKey is MEANSZMZZPMMIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21F2N5/c1-13-16(12-27(26-13)19-8-7-14(21)11-17(19)22)18-9-10-23-20(25-18)24-15-5-3-2-4-6-15/h7-12,15H,2-6H2,1H3,(H,23,24,25).
What are the key properties of N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine?
N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine has a molecular weight of 369.42 g/mol, XLogP of 4.66, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4-[1-(2,4-difluorophenyl)-3-methylpyrazol-4-yl]pyrimidin-2-amine is sourced from PubChem (CID 10177126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).