About (E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide
(E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide (PubChem CID 10177282) has the molecular formula C21H22F2N2O2
and a molecular weight of 372.42 g/mol. Its IUPAC name is (E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide |
| PubChem CID | 10177282 |
| Molecular Formula | C21H22F2N2O2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide |
| SMILES | C[C@H](NC(=O)/C=C/c1ccc(F)cc1F)c1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C21H22F2N2O2/c1-15(17-3-2-4-19(13-17)25-9-11-27-12-10-25)24-21(26)8-6-16-5-7-18(22)14-20(16)23/h2-8,13-15H,9-12H2,1H3,(H,24,26)/b8-6+/t15-/m0/s1 |
| InChIKey | PXLXPITXDJKOHW-VFADXPBXSA-N |
| XLogP | 3.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide?
The IUPAC name of (E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide (CID 10177282) is (E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide.
What is the SMILES notation for (E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide?
The canonical SMILES for (E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide is C[C@H](NC(=O)/C=C/c1ccc(F)cc1F)c1cccc(N2CCOCC2)c1.
What is the InChIKey of (E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide?
The InChIKey is PXLXPITXDJKOHW-VFADXPBXSA-N. The full InChI is InChI=1S/C21H22F2N2O2/c1-15(17-3-2-4-19(13-17)25-9-11-27-12-10-25)24-21(26)8-6-16-5-7-18(22)14-20(16)23/h2-8,13-15H,9-12H2,1H3,(H,24,26)/b8-6+/t15-/m0/s1.
What are the key properties of (E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide?
(E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide has a molecular weight of 372.42 g/mol, XLogP of 3.69, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2,4-difluorophenyl)-N-[(1S)-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide is sourced from PubChem (CID 10177282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).