C21H27NO5 — CID 10177349
2-methyl-5-[4-[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]butyl]-1,3-dioxane-2-carboxylic acid (PubChem CID 10177349) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-methyl-5-[4-[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]butyl]-1,3-dioxane-2-carboxylic acid.
| Compound Name | 2-methyl-5-[4-[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]butyl]-1,3-dioxane-2-carboxylic acid |
|---|---|
| PubChem CID | 10177349 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-methyl-5-[4-[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]butyl]-1,3-dioxane-2-carboxylic acid |
| SMILES | Cc1cccc(-c2nc(CCCCC3COC(C)(C(=O)O)OC3)c(C)o2)c1 |
| InChI | InChI=1S/C21H27NO5/c1-14-7-6-9-17(11-14)19-22-18(15(2)27-19)10-5-4-8-16-12-25-21(3,20(23)24)26-13-16/h6-7,9,11,16H,4-5,8,10,12-13H2,1-3H3,(H,23,24) |
| InChIKey | HAKGLNXMZVANHY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|