About [4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate
[4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate (PubChem CID 10177500) has the molecular formula C16H14ClN5O4
and a molecular weight of 375.77 g/mol. Its IUPAC name is [4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate.
Molecular Properties
| Compound Name | [4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate |
| PubChem CID | 10177500 |
| Molecular Formula | C16H14ClN5O4 |
| Molecular Weight | 375.77 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | [4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate |
| SMILES | Nc1nc(Cl)c2ncn(C3COC(COC(=O)c4ccccc4)O3)c2n1 |
| InChI | InChI=1S/C16H14ClN5O4/c17-13-12-14(21-16(18)20-13)22(8-19-12)10-6-24-11(26-10)7-25-15(23)9-4-2-1-3-5-9/h1-5,8,10-11H,6-7H2,(H2,18,20,21) |
| InChIKey | WLWWFFMPDQZMMO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.77 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate?
The IUPAC name of [4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate (CID 10177500) is [4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate.
What is the SMILES notation for [4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate?
The canonical SMILES for [4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate is Nc1nc(Cl)c2ncn(C3COC(COC(=O)c4ccccc4)O3)c2n1.
What is the InChIKey of [4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate?
The InChIKey is WLWWFFMPDQZMMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN5O4/c17-13-12-14(21-16(18)20-13)22(8-19-12)10-6-24-11(26-10)7-25-15(23)9-4-2-1-3-5-9/h1-5,8,10-11H,6-7H2,(H2,18,20,21).
What are the key properties of [4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate?
[4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate has a molecular weight of 375.77 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate is sourced from PubChem (CID 10177500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).