About 1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole
1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole (PubChem CID 10177537) has the molecular formula C19H18F2N2O2S
and a molecular weight of 376.43 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole.
Molecular Properties
| Compound Name | 1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole |
| PubChem CID | 10177537 |
| Molecular Formula | C19H18F2N2O2S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)n1cc(C2CCCNC2)c2ccccc21 |
| InChI | InChI=1S/C19H18F2N2O2S/c20-17-8-7-14(10-18(17)21)26(24,25)23-12-16(13-4-3-9-22-11-13)15-5-1-2-6-19(15)23/h1-2,5-8,10,12-13,22H,3-4,9,11H2 |
| InChIKey | WYIXSNCSCVYJDE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole?
The IUPAC name of 1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole (CID 10177537) is 1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole.
What is the SMILES notation for 1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole?
The canonical SMILES for 1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole is O=S(=O)(c1ccc(F)c(F)c1)n1cc(C2CCCNC2)c2ccccc21.
What is the InChIKey of 1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole?
The InChIKey is WYIXSNCSCVYJDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F2N2O2S/c20-17-8-7-14(10-18(17)21)26(24,25)23-12-16(13-4-3-9-22-11-13)15-5-1-2-6-19(15)23/h1-2,5-8,10,12-13,22H,3-4,9,11H2.
What are the key properties of 1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole?
1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole has a molecular weight of 376.43 g/mol, XLogP of 3.62, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-difluorophenyl)sulfonyl-3-piperidin-3-ylindole is sourced from PubChem (CID 10177537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).