C16H14F6N2O2 — CID 10177786
2-[4-[5-amino-3-[(E)-but-2-enyl]-1,2-oxazol-4-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 10177786) has the molecular formula C16H14F6N2O2 and a molecular weight of 380.29 g/mol. Its IUPAC name is 2-[4-[5-amino-3-[(E)-but-2-enyl]-1,2-oxazol-4-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[5-amino-3-[(E)-but-2-enyl]-1,2-oxazol-4-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 10177786 |
| Molecular Formula | C16H14F6N2O2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-[4-[5-amino-3-[(E)-but-2-enyl]-1,2-oxazol-4-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | C/C=C/Cc1noc(N)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F6N2O2/c1-2-3-4-11-12(13(23)26-24-11)9-5-7-10(8-6-9)14(25,15(17,18)19)16(20,21)22/h2-3,5-8,25H,4,23H2,1H3/b3-2+ |
| InChIKey | MOSPPSJYAWBHCQ-NSCUHMNNSA-N |
| XLogP | 4.35 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|