C25H36N2O — CID 10177825
3-[[(4-tert-butylphenyl)methyl-[2-[(2S)-1-methylpyrrolidin-2-yl]ethyl]amino]methyl]phenol (PubChem CID 10177825) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is 3-[[(4-tert-butylphenyl)methyl-[2-[(2S)-1-methylpyrrolidin-2-yl]ethyl]amino]methyl]phenol.
| Compound Name | 3-[[(4-tert-butylphenyl)methyl-[2-[(2S)-1-methylpyrrolidin-2-yl]ethyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 10177825 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | 3-[[(4-tert-butylphenyl)methyl-[2-[(2S)-1-methylpyrrolidin-2-yl]ethyl]amino]methyl]phenol |
| SMILES | CN1CCC[C@H]1CCN(Cc1ccc(C(C)(C)C)cc1)Cc1cccc(O)c1 |
| InChI | InChI=1S/C25H36N2O/c1-25(2,3)22-12-10-20(11-13-22)18-27(16-14-23-8-6-15-26(23)4)19-21-7-5-9-24(28)17-21/h5,7,9-13,17,23,28H,6,8,14-16,18-19H2,1-4H3/t23-/m0/s1 |
| InChIKey | ZSBRWILDZBIANU-QHCPKHFHSA-N |
| XLogP | 5.18 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |