C21H30N6O — CID 10177964
(4R)-4-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]hexan-3-ol (PubChem CID 10177964) has the molecular formula C21H30N6O and a molecular weight of 382.51 g/mol. Its IUPAC name is (4R)-4-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]hexan-3-ol.
| Compound Name | (4R)-4-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]hexan-3-ol |
|---|---|
| PubChem CID | 10177964 |
| Molecular Formula | C21H30N6O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (4R)-4-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]hexan-3-ol |
| SMILES | CCC(O)[C@@H](CC)Nc1nc(NCc2ccccc2)c2ncn(C(C)C)c2n1 |
| InChI | InChI=1S/C21H30N6O/c1-5-16(17(28)6-2)24-21-25-19(22-12-15-10-8-7-9-11-15)18-20(26-21)27(13-23-18)14(3)4/h7-11,13-14,16-17,28H,5-6,12H2,1-4H3,(H2,22,24,25,26)/t16-,17?/m1/s1 |
| InChIKey | DCBVAYFYFOLMIC-TZHYSIJRSA-N |
| XLogP | 3.98 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |