C15H16BrClN2OS — CID 10178314
1-(4-chlorophenyl)-2-(2-imino-4,5,6,7-tetrahydro-1,3-benzothiazol-3-yl)ethanone;hydrobromide (PubChem CID 10178314) has the molecular formula C15H16BrClN2OS and a molecular weight of 387.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(2-imino-4,5,6,7-tetrahydro-1,3-benzothiazol-3-yl)ethanone;hydrobromide.
| Compound Name | 1-(4-chlorophenyl)-2-(2-imino-4,5,6,7-tetrahydro-1,3-benzothiazol-3-yl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 10178314 |
| Molecular Formula | C15H16BrClN2OS |
| Molecular Weight | 387.73 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(2-imino-4,5,6,7-tetrahydro-1,3-benzothiazol-3-yl)ethanone;hydrobromide |
| SMILES | Br.[H]/N=c1\sc2c(n1CC(=O)c1ccc(Cl)cc1)CCCC2 |
| InChI | InChI=1S/C15H15ClN2OS.BrH/c16-11-7-5-10(6-8-11)13(19)9-18-12-3-1-2-4-14(12)20-15(18)17;/h5-8,17H,1-4,9H2;1H/b17-15-; |
| InChIKey | UOUQIPOYIWHTBD-NYDCQJDFSA-N |
| XLogP | 4.02 |
| TPSA | 45.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.73 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|