C20H24Cl2N4 — CID 10178517
2-(2,4-dichlorophenyl)-10-methyl-7-pentan-3-yl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene (PubChem CID 10178517) has the molecular formula C20H24Cl2N4 and a molecular weight of 391.35 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-10-methyl-7-pentan-3-yl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene.
| Compound Name | 2-(2,4-dichlorophenyl)-10-methyl-7-pentan-3-yl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene |
|---|---|
| PubChem CID | 10178517 |
| Molecular Formula | C20H24Cl2N4 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-10-methyl-7-pentan-3-yl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene |
| SMILES | CCC(CC)N1CCC2CN(c3ccc(Cl)cc3Cl)c3nc(C)nc1c32 |
| InChI | InChI=1S/C20H24Cl2N4/c1-4-15(5-2)25-9-8-13-11-26(17-7-6-14(21)10-16(17)22)20-18(13)19(25)23-12(3)24-20/h6-7,10,13,15H,4-5,8-9,11H2,1-3H3 |
| InChIKey | DAHAIPSBEBRKTA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |