C25H33N3O — CID 10178563
(3aR,7aR)-1-ethyl-3-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-one (PubChem CID 10178563) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is (3aR,7aR)-1-ethyl-3-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-one.
| Compound Name | (3aR,7aR)-1-ethyl-3-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 10178563 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | (3aR,7aR)-1-ethyl-3-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-one |
| SMILES | CCN1C(=O)N(C2CCN(Cc3ccc4ccccc4c3)CC2)[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C25H33N3O/c1-2-27-23-9-5-6-10-24(23)28(25(27)29)22-13-15-26(16-14-22)18-19-11-12-20-7-3-4-8-21(20)17-19/h3-4,7-8,11-12,17,22-24H,2,5-6,9-10,13-16,18H2,1H3/t23-,24-/m1/s1 |
| InChIKey | FTHQWELHZNAQSQ-DNQXCXABSA-N |
| XLogP | 4.87 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |