About methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate
methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate (PubChem CID 10178647) has the molecular formula C20H25ClN2O4
and a molecular weight of 392.88 g/mol. Its IUPAC name is methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate |
| PubChem CID | 10178647 |
| Molecular Formula | C20H25ClN2O4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate |
| SMILES | CCC(CO)Nc1cc(C)nc(Oc2c(C)cc(Cl)cc2C)c1C(=O)OC |
| InChI | InChI=1S/C20H25ClN2O4/c1-6-15(10-24)23-16-9-13(4)22-19(17(16)20(25)26-5)27-18-11(2)7-14(21)8-12(18)3/h7-9,15,24H,6,10H2,1-5H3,(H,22,23) |
| InChIKey | IWNVXQFPEPXFQP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate?
The IUPAC name of methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate (CID 10178647) is methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate.
What is the SMILES notation for methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate?
The canonical SMILES for methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate is CCC(CO)Nc1cc(C)nc(Oc2c(C)cc(Cl)cc2C)c1C(=O)OC.
What is the InChIKey of methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate?
The InChIKey is IWNVXQFPEPXFQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25ClN2O4/c1-6-15(10-24)23-16-9-13(4)22-19(17(16)20(25)26-5)27-18-11(2)7-14(21)8-12(18)3/h7-9,15,24H,6,10H2,1-5H3,(H,22,23).
What are the key properties of methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate?
methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate has a molecular weight of 392.88 g/mol, XLogP of 4.42, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-chloro-2,6-dimethylphenoxy)-4-(1-hydroxybutan-2-ylamino)-6-methylpyridine-3-carboxylate is sourced from PubChem (CID 10178647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).