About 2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol
2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol (PubChem CID 10178836) has the molecular formula C24H33N3O2
and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol.
Molecular Properties
| Compound Name | 2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol |
| PubChem CID | 10178836 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol |
| SMILES | CCCCN(CCCC)CCCOc1ccc(-c2cn3cccc(O)c3n2)cc1 |
| InChI | InChI=1S/C24H33N3O2/c1-3-5-14-26(15-6-4-2)16-8-18-29-21-12-10-20(11-13-21)22-19-27-17-7-9-23(28)24(27)25-22/h7,9-13,17,19,28H,3-6,8,14-16,18H2,1-2H3 |
| InChIKey | IUAMCFKBIUDPDK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 50.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol?
The IUPAC name of 2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol (CID 10178836) is 2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol.
What is the SMILES notation for 2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol?
The canonical SMILES for 2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol is CCCCN(CCCC)CCCOc1ccc(-c2cn3cccc(O)c3n2)cc1.
What is the InChIKey of 2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol?
The InChIKey is IUAMCFKBIUDPDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33N3O2/c1-3-5-14-26(15-6-4-2)16-8-18-29-21-12-10-20(11-13-21)22-19-27-17-7-9-23(28)24(27)25-22/h7,9-13,17,19,28H,3-6,8,14-16,18H2,1-2H3.
What are the key properties of 2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol?
2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol has a molecular weight of 395.55 g/mol, XLogP of 5.38, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-ol is sourced from PubChem (CID 10178836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).