C24H28O5 — CID 10178877
methyl 3-[(1R,2S,15S,16S,18R)-15-hydroxy-2,16-dimethyl-5-oxo-19-oxahexacyclo[9.8.0.01,18.02,7.08,10.012,16]nonadeca-6,8(10),13-trien-15-yl]propanoate (PubChem CID 10178877) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is methyl 3-[(1R,2S,15S,16S,18R)-15-hydroxy-2,16-dimethyl-5-oxo-19-oxahexacyclo[9.8.0.01,18.02,7.08,10.012,16]nonadeca-6,8(10),13-trien-15-yl]propanoate.
| Compound Name | methyl 3-[(1R,2S,15S,16S,18R)-15-hydroxy-2,16-dimethyl-5-oxo-19-oxahexacyclo[9.8.0.01,18.02,7.08,10.012,16]nonadeca-6,8(10),13-trien-15-yl]propanoate |
|---|---|
| PubChem CID | 10178877 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | methyl 3-[(1R,2S,15S,16S,18R)-15-hydroxy-2,16-dimethyl-5-oxo-19-oxahexacyclo[9.8.0.01,18.02,7.08,10.012,16]nonadeca-6,8(10),13-trien-15-yl]propanoate |
| SMILES | COC(=O)CC[C@]1(O)C=CC2C3C4=C(C4)C4=CC(=O)CC[C@]4(C)[C@]34O[C@@H]4C[C@@]21C |
| InChI | InChI=1S/C24H28O5/c1-21-7-4-13(25)10-17(21)14-11-15(14)20-16-5-8-23(27,9-6-19(26)28-3)22(16,2)12-18-24(20,21)29-18/h5,8,10,16,18,20,27H,4,6-7,9,11-12H2,1-3H3/t16?,18-,20?,21+,22+,23-,24-/m1/s1 |
| InChIKey | VGURAOPVZPJTRN-VNTIPFHRSA-N |
| XLogP | 3.03 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|