C16H13F6NO4 — CID 10178913
ethyl 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazole-3-carboxylate (PubChem CID 10178913) has the molecular formula C16H13F6NO4 and a molecular weight of 397.27 g/mol. Its IUPAC name is ethyl 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 10178913 |
| Molecular Formula | C16H13F6NO4 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | ethyl 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1noc(C)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13F6NO4/c1-3-26-13(24)12-11(8(2)27-23-12)9-4-6-10(7-5-9)14(25,15(17,18)19)16(20,21)22/h4-7,25H,3H2,1-2H3 |
| InChIKey | RFNJTAVYNOVWTB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |