C15H12F6N2O4 — CID 10178967
3-[5-amino-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,2-oxazol-3-yl]propanoic acid (PubChem CID 10178967) has the molecular formula C15H12F6N2O4 and a molecular weight of 398.26 g/mol. Its IUPAC name is 3-[5-amino-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,2-oxazol-3-yl]propanoic acid.
| Compound Name | 3-[5-amino-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,2-oxazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 10178967 |
| Molecular Formula | C15H12F6N2O4 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 3-[5-amino-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,2-oxazol-3-yl]propanoic acid |
| SMILES | Nc1onc(CCC(=O)O)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12F6N2O4/c16-14(17,18)13(26,15(19,20)21)8-3-1-7(2-4-8)11-9(5-6-10(24)25)23-27-12(11)22/h1-4,26H,5-6,22H2,(H,24,25) |
| InChIKey | CFSHLKQNSVJTKI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |